Q14289 FAK2_HUMAN
Gene name: PTK2B
Protein name: Protein-tyrosine kinase 2-beta
List of molecules and drugs that target protein Q14289
# | DrugDomain Data | DrugBank Accession | Name | Drug action | Affinity data | InChI Key | SMILES |
---|---|---|---|---|---|---|---|
1 | Q14289_DB01097 | DB01097 | Leflunomide | antagonist | VHOGYURTWQBHIL-UHFFFAOYSA-N | CC1=C(C=NO1)C(=O)NC1=CC=C(C=C1)C(F)(F)F | |
2 | Q14289_DB01645 | DB01645 | Genistein | n/a | TZBJGXHYKVUXJN-UHFFFAOYSA-N | OC1=CC=C(C=C1)C1=COC2=C(C(O)=CC(O)=C2)C1=O | |
3 | Q14289_DB08341 | DB08341 | 4-{[4-{[(1R,2R)-2-(dimethylamino)cyclopentyl]amino}-5-(trifluoromethyl)pyrimidin-2-yl]amino}-N-methylbenzenesulfonamide | n/a | IC50(nM) = 88.0 | CAUFYHKGKDJMQG-HZPDHXFCSA-N | [H][C@]1(CCC[C@@]1([H])N(C)C)NC1=NC(NC2=CC=C(C=C2)S(=O)(=O)NC)=NC=C1C(F)(F)F |
4 | Q14289_DB12010 | DB12010 | Fostamatinib | inhibitor | GKDRMWXFWHEQQT-UHFFFAOYSA-N | COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC |