DB06354 Tezampanel
InChI Key: ZXFRFPSZAKNPQQ-YTWAJWBKSA-N
SMILES: [H][C@]1(CCC2=NN=NN2)CC[C@@]2([H])CN[C@@]([H])(C[C@@]2([H])C1)C(O)=O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P39086
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P39086 | Download | Predicted | P39086_nD3 P39086_nD1 P39086_nD2 P39086_nD5 | Periplasmic binding protein-like II Flavodoxin-like Flavodoxin-like Periplasmic binding protein-like II | |
| 2ZNS | Predicted | e2znsA1 | |||
| 2ZNT | Predicted | e2zntA2 | |||
| 2ZNU | Predicted | e2znuA2 | |||
| 3FUZ | Predicted | e3fuzA2 e3fuzB2 | |||
| 3FV1 | Predicted | e3fv1A2 e3fv1B1 | |||
| 3FV2 | Predicted | e3fv2A1 e3fv2B2 | |||
| 3FVG | Predicted | e3fvgA2 e3fvgB2 | |||
| 3FVK | Predicted | e3fvkA2 e3fvkB1 | |||
| 3FVN | Predicted | e3fvnA1 e3fvnB1 | |||
| 3FVO | Predicted | e3fvoA2 e3fvoB2 | |||
| 4MF3 | Predicted | e4mf3A1 e4mf3B1 |