DB12147 Erdafitinib
InChI Key: OLAHOMJCDNXHFI-UHFFFAOYSA-N
SMILES: COC1=CC(=CC(OC)=C1)N(CCNC(C)C)C1=CC=C2N=CC(=NC2=C1)C1=CN(C)N=C1
Small molecule PDB accession : 5SF
List of proteins that are targets for DB12147
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | P22455_DB12147 | P22455 | inhibitor | Fibroblast growth factor receptor 4 | |
| 2 | P07333_DB12147 | P07333 | substrate | Macrophage colony-stimulating factor 1 receptor | |
| 3 | P35968_DB12147 | P35968 | substrate | Vascular endothelial growth factor receptor 2 | |
| 4 | P22607_DB12147 | P22607 | inhibitor | Fibroblast growth factor receptor 3 | |
| 5 | P10721_DB12147 | P10721 | substrate | Mast/stem cell growth factor receptor Kit | |
| 6 | P16234_DB12147 | P16234 | substrate | Platelet-derived growth factor receptor alpha | |
| 7 | P09619_DB12147 | P09619 | substrate | Platelet-derived growth factor receptor beta | |
| 8 | P21802_DB12147 | P21802 | inhibitor | Fibroblast growth factor receptor 2 | |
| 9 | P11362_DB12147 | P11362 | inhibitor | Fibroblast growth factor receptor 1 |