DB03496 Alvocidib
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl
Small molecule PDB accession : CPB
List of proteins that are targets for DB03496
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P11216_DB03496 | P11216 | n/a | Glycogen phosphorylase, brain form | |
2 | P06493_DB03496 | P06493 | n/a | Cyclin-dependent kinase 1 | Ki(nM) = 40.0 IC50(nM) = 10.0 |
3 | P49336_DB03496 | P49336 | n/a | Cyclin-dependent kinase 8 | Kd(nM) = 120.0 |
4 | P50750_DB03496 | P50750 | n/a | Cyclin-dependent kinase 9 | Ki(nM) = 3.0 IC50(nM) = 3.0 Kd(nM) = 6.4 |
5 | P11802_DB03496 | P11802 | n/a | Cyclin-dependent kinase 4 | Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 3.3 |
6 | P11217_DB03496 | P11217 | n/a | Glycogen phosphorylase, muscle form | IC50(nM) = 1000.0 |
7 | P50613_DB03496 | P50613 | n/a | Cyclin-dependent kinase 7 | IC50(nM) = 10.0 Kd(nM) = 23.0 |
8 | P00533_DB03496 | P00533 | n/a | Epidermal growth factor receptor | IC50(nM) = 21000.0 Kd(nM) = 520.0 |
9 | Q00535_DB03496 | Q00535 | n/a | Cyclin-dependent-like kinase 5 | IC50(nM) = 170.0 Kd(nM) = 43.0 |
10 | Q00534_DB03496 | Q00534 | n/a | Cyclin-dependent kinase 6 | IC50(nM) = 20.0 |
11 | P24941_DB03496 | P24941 | inhibitor | Cyclin-dependent kinase 2 | Ki(nM) = 40.0 IC50(nM) = 10.0 Kd(nM) = 200.0 |