DB03496 Alvocidib

InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl
Small molecule PDB accession : CPB

List of proteins that are targets for DB03496
# DrugDomain Data UniProt Accession Drug action Protein name Affinity data
1 P11216_DB03496 P11216 n/a Glycogen phosphorylase, brain form
2 P06493_DB03496 P06493 n/a Cyclin-dependent kinase 1 Ki(nM) = 40.0
IC50(nM) = 10.0
3 P49336_DB03496 P49336 n/a Cyclin-dependent kinase 8 Kd(nM) = 120.0
4 P50750_DB03496 P50750 n/a Cyclin-dependent kinase 9 Ki(nM) = 3.0
IC50(nM) = 3.0
Kd(nM) = 6.4
5 P11802_DB03496 P11802 n/a Cyclin-dependent kinase 4 Ki(nM) = 40.0
IC50(nM) = 10.0
Kd(nM) = 3.3
6 P11217_DB03496 P11217 n/a Glycogen phosphorylase, muscle form IC50(nM) = 1000.0
7 P50613_DB03496 P50613 n/a Cyclin-dependent kinase 7 IC50(nM) = 10.0
Kd(nM) = 23.0
8 P00533_DB03496 P00533 n/a Epidermal growth factor receptor IC50(nM) = 21000.0
Kd(nM) = 520.0
9 Q00535_DB03496 Q00535 n/a Cyclin-dependent-like kinase 5 IC50(nM) = 170.0
Kd(nM) = 43.0
10 Q00534_DB03496 Q00534 n/a Cyclin-dependent kinase 6 IC50(nM) = 20.0
11 P24941_DB03496 P24941 inhibitor Cyclin-dependent kinase 2 Ki(nM) = 40.0
IC50(nM) = 10.0
Kd(nM) = 200.0