DB14487 Zinc acetate
InChI Key: DJWUNCQRNNEAKC-UHFFFAOYSA-L
SMILES: [Zn++].CC([O-])=O.CC([O-])=O
Small molecule PDB accession : n/a
List of proteins that are targets for DB14487
# | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
---|---|---|---|---|---|
1 | P04279_DB14487 | P04279 | n/a | Semenogelin-1 | |
2 | P35858_DB14487 | P35858 | n/a | Insulin-like growth factor-binding protein complex acid labile subunit | |
3 | O14791_DB14487 | O14791 | n/a | Apolipoprotein L1 | |
4 | P46663_DB14487 | P46663 | n/a | B1 bradykinin receptor | |
5 | P49411_DB14487 | P49411 | n/a | Elongation factor Tu, mitochondrial | |
6 | P0C0L5_DB14487 | P0C0L5 | n/a | Complement C4-B | |
7 | P01591_DB14487 | P01591 | n/a | Immunoglobulin J chain | |
8 | P46736_DB14487 | P46736 | n/a | Lys-63-specific deubiquitinase BRCC36 | |
9 | P19827_DB14487 | P19827 | n/a | Inter-alpha-trypsin inhibitor heavy chain H1 | |
10 | P29622_DB14487 | P29622 | n/a | Kallistatin | |
11 | P02538_DB14487 | P02538 | n/a | Keratin, type II cytoskeletal 6A | |
12 | Q06481_DB14487 | Q06481 | n/a | Amyloid-like protein 2 | |
13 | P04264_DB14487 | P04264 | n/a | Keratin, type II cytoskeletal 1 | |
14 | P01619_DB14487 | P01619 | n/a | Immunoglobulin kappa variable 3-20 | |
15 | Q13547_DB14487 | Q13547 | n/a | Histone deacetylase 1 | |
16 | P00748_DB14487 | P00748 | n/a | Coagulation factor XII | |
17 | P02533_DB14487 | P02533 | n/a | Keratin, type I cytoskeletal 14 | |
18 | P13647_DB14487 | P13647 | n/a | Keratin, type II cytoskeletal 5 | |
19 | P06727_DB14487 | P06727 | n/a | Apolipoprotein A-IV | |
20 | P51693_DB14487 | P51693 | n/a | Amyloid-like protein 1 | |
21 | P07358_DB14487 | P07358 | n/a | Complement component C8 beta chain | |
22 | P14923_DB14487 | P14923 | n/a | Junction plakoglobin | |
23 | O14556_DB14487 | O14556 | n/a | Glyceraldehyde-3-phosphate dehydrogenase, testis-specific | |
24 | P68104_DB14487 | P68104 | n/a | Elongation factor 1-alpha 1 | |
25 | P13645_DB14487 | P13645 | n/a | Keratin, type I cytoskeletal 10 | |
26 | P19652_DB14487 | P19652 | n/a | Alpha-1-acid glycoprotein 2 | |
27 | O75340_DB14487 | O75340 | n/a | Programmed cell death protein 6 | |
28 | P05156_DB14487 | P05156 | n/a | Complement factor I | |
29 | P08185_DB14487 | P08185 | n/a | Corticosteroid-binding globulin | |
30 | Q06830_DB14487 | Q06830 | n/a | Peroxiredoxin-1 | |
31 | P29034_DB14487 | P29034 | n/a | Protein S100-A2 | |
32 | P07357_DB14487 | P07357 | n/a | Complement component C8 alpha chain | |
33 | P06733_DB14487 | P06733 | n/a | Alpha-enolase | |
34 | P15169_DB14487 | P15169 | n/a | Carboxypeptidase N catalytic chain | |
35 | P81605_DB14487 | P81605 | n/a | Dermcidin | |
36 | O75636_DB14487 | O75636 | n/a | ||
37 | P45381_DB14487 | P45381 | n/a | Aspartoacylase | |
38 | P56524_DB14487 | P56524 | n/a | Histone deacetylase 4 | |
39 | P25713_DB14487 | P25713 | n/a | Metallothionein-3 | |
40 | P03952_DB14487 | P03952 | n/a | Plasma kallikrein | |
41 | P30101_DB14487 | P30101 | n/a | Protein disulfide-isomerase A3 | |
42 | P04003_DB14487 | P04003 | n/a | C4b-binding protein alpha chain | |
43 | P27169_DB14487 | P27169 | n/a | Serum paraoxonase/arylesterase 1 | |
44 | P09874_DB14487 | P09874 | n/a | Poly [ADP-ribose] polymerase 1 | |
45 | Q9BY41_DB14487 | Q9BY41 | n/a | Histone deacetylase 8 | |
46 | Q00987_DB14487 | Q00987 | n/a | E3 ubiquitin-protein ligase Mdm2 | |
47 | P31151_DB14487 | P31151 | n/a | Protein S100-A7 | |
48 | P02747_DB14487 | P02747 | n/a | ||
49 | P02746_DB14487 | P02746 | n/a | ||
50 | P04004_DB14487 | P04004 | n/a | Vitronectin | |
51 | P01042_DB14487 | P01042 | n/a | Kininogen-1 | |
52 | P01019_DB14487 | P01019 | n/a | Angiotensinogen | |
53 | P05109_DB14487 | P05109 | n/a | Protein S100-A8 | |
54 | P23415_DB14487 | P23415 | n/a | Glycine receptor subunit alpha-1 | |
55 | P02795_DB14487 | P02795 | n/a | Metallothionein-2 | |
56 | P15924_DB14487 | P15924 | n/a | Desmoplakin | |
57 | P78330_DB14487 | P78330 | n/a | Phosphoserine phosphatase | |
58 | P00450_DB14487 | P00450 | n/a | Ceruloplasmin | |
59 | P15531_DB14487 | P15531 | n/a | Nucleoside diphosphate kinase A | |
60 | P05546_DB14487 | P05546 | n/a | Heparin cofactor 2 | |
61 | P08700_DB14487 | P08700 | n/a | Interleukin-3 | |
62 | P07360_DB14487 | P07360 | n/a | Complement component C8 gamma chain | |
63 | P06702_DB14487 | P06702 | n/a | Protein S100-A9 | |
64 | P01876_DB14487 | P01876 | n/a | Immunoglobulin heavy constant alpha 1 | |
65 | P60174_DB14487 | P60174 | n/a | Triosephosphate isomerase | |
66 | P01871_DB14487 | P01871 | n/a | Immunoglobulin heavy constant mu | |
67 | P08603_DB14487 | P08603 | n/a | Complement factor H | |
68 | P02743_DB14487 | P02743 | n/a | Serum amyloid P-component | |
69 | P14780_DB14487 | P14780 | n/a | Matrix metalloproteinase-9 | |
70 | P09871_DB14487 | P09871 | n/a | Complement C1s subcomponent | |
71 | P16455_DB14487 | P16455 | n/a | Methylated-DNA--protein-cysteine methyltransferase | |
72 | P02751_DB14487 | P02751 | n/a | Fibronectin | |
73 | O14618_DB14487 | O14618 | n/a | Copper chaperone for superoxide dismutase | |
74 | P00751_DB14487 | P00751 | n/a | Complement factor B | |
75 | P04278_DB14487 | P04278 | n/a | Sex hormone-binding globulin | |
76 | O15350_DB14487 | O15350 | n/a | Tumor protein p73 | |
77 | P01031_DB14487 | P01031 | n/a | Complement C5 | |
78 | P01024_DB14487 | P01024 | n/a | Complement C3 | |
79 | P06396_DB14487 | P06396 | n/a | Gelsolin | |
80 | P01023_DB14487 | P01023 | n/a | Alpha-2-macroglobulin | |
81 | P29372_DB14487 | P29372 | n/a | DNA-3-methyladenine glycosylase | |
82 | P02766_DB14487 | P02766 | n/a | Transthyretin | |
83 | P07237_DB14487 | P07237 | n/a | Protein disulfide-isomerase | |
84 | P46939_DB14487 | P46939 | n/a | Utrophin | |
85 | P02671_DB14487 | P02671 | n/a | Fibrinogen alpha chain [Cleaved into: Fibrinopeptide A; Fibrinogen alpha chain] | |
86 | P02649_DB14487 | P02649 | n/a | Apolipoprotein E | |
87 | P00441_DB14487 | P00441 | n/a | Superoxide dismutase [Cu-Zn] | |
88 | P02647_DB14487 | P02647 | n/a | Apolipoprotein A-I | |
89 | P01009_DB14487 | P01009 | n/a | Alpha-1-antitrypsin | |
90 | P01011_DB14487 | P01011 | n/a | Alpha-1-antichymotrypsin | |
91 | P00736_DB14487 | P00736 | n/a | Complement C1r subcomponent | |
92 | P04075_DB14487 | P04075 | n/a | Fructose-bisphosphate aldolase A | |
93 | P05067_DB14487 | P05067 | n/a | Amyloid-beta precursor protein | |
94 | P02787_DB14487 | P02787 | n/a | Serotransferrin | |
95 | P01308_DB14487 | P01308 | n/a | Insulin [Cleaved into: Insulin B chain; Insulin A chain] | |
96 | P03372_DB14487 | P03372 | n/a | Estrogen receptor | |
97 | P00734_DB14487 | P00734 | n/a | Prothrombin | |
98 | P04637_DB14487 | P04637 | n/a | Cellular tumor antigen p53 | |
99 | P68871_DB14487 | P68871 | n/a | Hemoglobin subunit beta | |
100 | P69905_DB14487 | P69905 | n/a | Hemoglobin subunit alpha | |
101 | Q0VD83_DB14487 | Q0VD83 | n/a | Apolipoprotein B receptor | |
102 | P22792_DB14487 | P22792 | n/a | Carboxypeptidase N subunit 2 | |
103 | P35908_DB14487 | P35908 | n/a | Keratin, type II cytoskeletal 2 epidermal | |
104 | P49908_DB14487 | P49908 | n/a | Selenoprotein P | |
105 | P05160_DB14487 | P05160 | n/a | Coagulation factor XIII B chain | |
106 | P02652_DB14487 | P02652 | n/a | Apolipoprotein A-II | |
107 | P02765_DB14487 | P02765 | n/a | Alpha-2-HS-glycoprotein | |
108 | P10909_DB14487 | P10909 | n/a | Clusterin | |
109 | P19823_DB14487 | P19823 | n/a | Inter-alpha-trypsin inhibitor heavy chain H2 | |
110 | P35527_DB14487 | P35527 | n/a | Keratin, type I cytoskeletal 9 | |
111 | Q96PD5_DB14487 | Q96PD5 | n/a | N-acetylmuramoyl-L-alanine amidase | |
112 | P00739_DB14487 | P00739 | n/a | Haptoglobin-related protein | |
113 | P04217_DB14487 | P04217 | n/a | Alpha-1B-glycoprotein | |
114 | O15304_DB14487 | O15304 | n/a | Apoptosis regulatory protein Siva | |
115 | P20742_DB14487 | P20742 | n/a | Pregnancy zone protein | |
116 | P20851_DB14487 | P20851 | n/a | C4b-binding protein beta chain | |
117 | Q06033_DB14487 | Q06033 | n/a | Inter-alpha-trypsin inhibitor heavy chain H3 | |
118 | Q14624_DB14487 | Q14624 | n/a | Inter-alpha-trypsin inhibitor heavy chain H4 | |
119 | P01599_DB14487 | P01599 | n/a | Immunoglobulin kappa variable 1-17 | |
120 | P08779_DB14487 | P08779 | n/a | Keratin, type I cytoskeletal 16 | |
121 | Q86YZ3_DB14487 | Q86YZ3 | n/a | Hornerin | |
122 | P80748_DB14487 | P80748 | n/a | Immunoglobulin lambda variable 3-21 | |
123 | Q8N907_DB14487 | Q8N907 | n/a | DAN domain family member 5 | |
124 | P04731_DB14487 | P04731 | n/a | Metallothionein-1A |