DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
List of proteins that are targets for DB11638
| # | DrugDomain Data | UniProt Accession | Drug action | Protein name | Affinity data |
|---|---|---|---|---|---|
| 1 | O75964_DB11638 | O75964 | ligand | ATP synthase subunit g, mitochondrial | |
| 2 | P48047_DB11638 | P48047 | ligand | ATP synthase subunit O, mitochondrial | |
| 3 | P25705_DB11638 | P25705 | ligand | ATP synthase subunit alpha, mitochondrial | |
| 4 | P40925_DB11638 | P40925 | ligand | Malate dehydrogenase, cytoplasmic | |
| 5 | P49368_DB11638 | P49368 | ligand | T-complex protein 1 subunit gamma | |
| 6 | P63261_DB11638 | P63261 | ligand | Actin, cytoplasmic 2 | |
| 7 | Q71U36_DB11638 | Q71U36 | ligand | Tubulin alpha-1A chain | |
| 8 | P23246_DB11638 | P23246 | ligand | Splicing factor, proline- and glutamine-rich | |
| 9 | P50914_DB11638 | P50914 | ligand | 60S ribosomal protein L14 | |
| 10 | Q07020_DB11638 | Q07020 | ligand | 60S ribosomal protein L18 | |
| 11 | P42766_DB11638 | P42766 | ligand | 60S ribosomal protein L35 | |
| 12 | P62750_DB11638 | P62750 | ligand | 60S ribosomal protein L23a | |
| 13 | P36578_DB11638 | P36578 | ligand | 60S ribosomal protein L4 | |
| 14 | P39019_DB11638 | P39019 | ligand | 40S ribosomal protein S19 | |
| 15 | P46781_DB11638 | P46781 | ligand | 40S ribosomal protein S9 | |
| 16 | P62241_DB11638 | P62241 | ligand | 40S ribosomal protein S8 | |
| 17 | P46782_DB11638 | P46782 | ligand | 40S ribosomal protein S5 | |
| 18 | P62269_DB11638 | P62269 | ligand | 40S ribosomal protein S18 | |
| 19 | P62857_DB11638 | P62857 | ligand | 40S ribosomal protein S28 | |
| 20 | P62277_DB11638 | P62277 | ligand | 40S ribosomal protein S13 | |
| 21 | P08708_DB11638 | P08708 | ligand | 40S ribosomal protein S17 | |
| 22 | P62753_DB11638 | P62753 | ligand | 40S ribosomal protein S6 | |
| 23 | P34897_DB11638 | P34897 | ligand | Serine hydroxymethyltransferase, mitochondrial | |
| 24 | P07437_DB11638 | P07437 | ligand | Tubulin beta chain | |
| 25 | P09493_DB11638 | P09493 | ligand | Tropomyosin alpha-1 chain | |
| 26 | Q9C0B1_DB11638 | Q9C0B1 | ligand | Alpha-ketoglutarate-dependent dioxygenase FTO | |
| 27 | O14556_DB11638 | O14556 | ligand | Glyceraldehyde-3-phosphate dehydrogenase, testis-specific | |
| 28 | P17844_DB11638 | P17844 | ligand | Probable ATP-dependent RNA helicase DDX5 | |
| 29 | P68104_DB11638 | P68104 | ligand | Elongation factor 1-alpha 1 | |
| 30 | P11142_DB11638 | P11142 | ligand | Heat shock cognate 71 kDa protein | |
| 31 | P00558_DB11638 | P00558 | ligand | Phosphoglycerate kinase 1 | |
| 32 | Q5SSJ5_DB11638 | Q5SSJ5 | ligand | Heterochromatin protein 1-binding protein 3 | |
| 33 | Q06830_DB11638 | Q06830 | ligand | Peroxiredoxin-1 | |
| 34 | P06733_DB11638 | P06733 | ligand | Alpha-enolase | |
| 35 | P27635_DB11638 | P27635 | ligand | 60S ribosomal protein L10 | |
| 36 | P04792_DB11638 | P04792 | ligand | Heat shock protein beta-1 | |
| 37 | P35579_DB11638 | P35579 | ligand | Myosin-9 | |
| 38 | P06748_DB11638 | P06748 | ligand | Nucleophosmin | |
| 39 | P49419_DB11638 | P49419 | ligand | Alpha-aminoadipic semialdehyde dehydrogenase | |
| 40 | Q92945_DB11638 | Q92945 | ligand | Far upstream element-binding protein 2 | |
| 41 | Q16555_DB11638 | Q16555 | ligand | Dihydropyrimidinase-related protein 2 | |
| 42 | P21333_DB11638 | P21333 | ligand | Filamin-A | |
| 43 | P18669_DB11638 | P18669 | ligand | Phosphoglycerate mutase 1 | |
| 44 | P22626_DB11638 | P22626 | ligand | Heterogeneous nuclear ribonucleoproteins A2/B1 | |
| 45 | P46940_DB11638 | P46940 | ligand | Ras GTPase-activating-like protein IQGAP1 | |
| 46 | P37802_DB11638 | P37802 | ligand | Transgelin-2 | |
| 47 | P07355_DB11638 | P07355 | ligand | Annexin A2 | |
| 48 | P04406_DB11638 | P04406 | ligand | Glyceraldehyde-3-phosphate dehydrogenase | |
| 49 | Q13838_DB11638 | Q13838 | ligand | Spliceosome RNA helicase DDX39B | |
| 50 | P14618_DB11638 | P14618 | ligand | Pyruvate kinase PKM | |
| 51 | P11413_DB11638 | P11413 | ligand | Glucose-6-phosphate 1-dehydrogenase | |
| 52 | P23528_DB11638 | P23528 | ligand | Cofilin-1 | |
| 53 | P15924_DB11638 | P15924 | ligand | Desmoplakin | |
| 54 | Q15637_DB11638 | Q15637 | ligand | Splicing factor 1 | |
| 55 | O00299_DB11638 | O00299 | ligand | Chloride intracellular channel protein 1 | |
| 56 | P61978_DB11638 | P61978 | ligand | Heterogeneous nuclear ribonucleoprotein K | |
| 57 | P99999_DB11638 | P99999 | ligand | Cytochrome c | |
| 58 | P06744_DB11638 | P06744 | ligand | Glucose-6-phosphate isomerase | |
| 59 | P00338_DB11638 | P00338 | ligand | L-lactate dehydrogenase A chain | |
| 60 | P07195_DB11638 | P07195 | ligand | L-lactate dehydrogenase B chain | |
| 61 | P60174_DB11638 | P60174 | ligand | Triosephosphate isomerase | |
| 62 | Q14103_DB11638 | Q14103 | ligand | Heterogeneous nuclear ribonucleoprotein D0 | |
| 63 | P09382_DB11638 | P09382 | ligand | Galectin-1 | |
| 64 | P08670_DB11638 | P08670 | ligand | Vimentin | |
| 65 | P37108_DB11638 | P37108 | ligand | Signal recognition particle 14 kDa protein | |
| 66 | P07237_DB11638 | P07237 | ligand | Protein disulfide-isomerase | |
| 67 | P62316_DB11638 | P62316 | ligand | Small nuclear ribonucleoprotein Sm D2 | |
| 68 | P07737_DB11638 | P07737 | ligand | Profilin-1 | |
| 69 | P02768_DB11638 | P02768 | ligand | Albumin | |
| 70 | P04075_DB11638 | P04075 | ligand | Fructose-bisphosphate aldolase A | |
| 71 | P62937_DB11638 | P62937 | ligand | Peptidyl-prolyl cis-trans isomerase A | |
| 72 | P55786_DB11638 | P55786 | ligand | Puromycin-sensitive aminopeptidase | |
| 73 | P04350_DB11638 | P04350 | ligand | Tubulin beta-4A chain | |
| 74 | Q9BUF5_DB11638 | Q9BUF5 | ligand | Tubulin beta-6 chain | |
| 75 | P20810_DB11638 | P20810 | ligand | Calpastatin | |
| 76 | P27816_DB11638 | P27816 | ligand | Microtubule-associated protein 4 | |
| 77 | P21291_DB11638 | P21291 | ligand | Cysteine and glycine-rich protein 1 | |
| 78 | Q08170_DB11638 | Q08170 | ligand | Serine/arginine-rich splicing factor 4 | |
| 79 | Q15942_DB11638 | Q15942 | ligand | Zyxin | |
| 80 | Q01995_DB11638 | Q01995 | ligand | Transgelin |